CAS 1803604-63-8 is the registry number for 6-Chloro-3-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-3-methyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile (CAS 1803604-63-8) is a chemical compound with the molecular formula C6H4ClN3O2 and a molecular weight of 185.57 g/mol. IUPAC name: 6-chloro-3-methyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile. InChIKey: NRGGSKQJLCNFET-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3O2 |
|---|---|
| Molecular weight | 185.57 g/mol |
| IUPAC name | 6-chloro-3-methyl-2,4-dioxo-1H-pyrimidine-5-carbonitrile |
| InChIKey | NRGGSKQJLCNFET-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(NC1=O)Cl)C#N |
Computed by PubChem (NCBI)