CAS 2913572-33-3 is the registry number for 8-Chloro-2,3-dihydropyrrolo[1,2-d][1,2,4]triazine-1,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-2,3-dihydropyrrolo[1,2-d][1,2,4]triazine-1,4-dione (CAS 2913572-33-3) is a chemical compound with the molecular formula C6H4ClN3O2 and a molecular weight of 185.57 g/mol. IUPAC name: 8-chloro-2,3-dihydropyrrolo[1,2-d][1,2,4]triazine-1,4-dione. InChIKey: VFLWSCRUKRJLPB-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3O2 |
|---|---|
| Molecular weight | 185.57 g/mol |
| IUPAC name | 8-chloro-2,3-dihydropyrrolo[1,2-d][1,2,4]triazine-1,4-dione |
| InChIKey | VFLWSCRUKRJLPB-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1Cl)C(=O)NNC2=O |
Computed by PubChem (NCBI)