CAS 142437-69-2 is the registry number for Mirabegron Impurity 71. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(4-nitrophenyl)ethyl]benzamide (CAS 142437-69-2) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: N-[2-(4-nitrophenyl)ethyl]benzamide. InChIKey: XTKJFYIJGQVOMT-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | N-[2-(4-nitrophenyl)ethyl]benzamide |
| InChIKey | XTKJFYIJGQVOMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)