Products 142474-52-0
CAS 142474-52-0 appears in our catalog under these names: Glyasperin A, Glyasperin A, 99.65%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 1 mg.
3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-6-(3-methylbut-2-enyl)chromen-4-one (CAS 142474-52-0) is a chemical compound with the molecular formula C25H26O6 and a molecular weight of 422.5 g/mol. IUPAC name: 3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-6-(3-methylbut-2-enyl)chromen-4-one. InChIKey: XHCCZOWAHHBCAK-UHFFFAOYSA-N.
| Molecular formula | C25H26O6 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 3,5,7-trihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-6-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | XHCCZOWAHHBCAK-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)C2=C(C(=O)C3=C(O2)C=C(C(=C3O)CC=C(C)C)O)O)O)C |
Computed by PubChem (NCBI)