CAS 1426174-36-8 appears in our catalog under these names: (2S)-N'-Nitrosonornicotine-d4, (2S)-N’-Nitrosonornicotine-d4, N-Nitrosonornicotine-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, Get quote.
2,3,4,6-tetradeuterio-5-[(2S)-1-nitrosopyrrolidin-2-yl]pyridine (CAS 1426174-36-8) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 181.23 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-[(2S)-1-nitrosopyrrolidin-2-yl]pyridine. InChIKey: XKABJYQDMJTNGQ-FUQHWSCXSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-[(2S)-1-nitrosopyrrolidin-2-yl]pyridine |
| InChIKey | XKABJYQDMJTNGQ-FUQHWSCXSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])[C@@H]2CCCN2N=O)[2H] |
Computed by PubChem (NCBI)