CAS 66148-19-4 appears in our catalog under these names: N-Nitrosonornicotine-d4, rac N’-Nitrosonornicotine-d4, >95% (HPLC), rac N'-Nitrosonornicotine-d4, >95% (HPLC), rac N'-Nitrosonornicotine-d4 (1.0 mg/mL in Acetonitrile), rac N’-Nitrosonornicotine-d4 (0.1 mg/mL in Methanol). Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 25mg, 1x1ml, 5x1ml, 0,1g, 0,05g.
2,3,4,6-tetradeuterio-5-(1-nitrosopyrrolidin-2-yl)pyridine (CAS 66148-19-4) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 181.23 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-(1-nitrosopyrrolidin-2-yl)pyridine. InChIKey: XKABJYQDMJTNGQ-DNZPNURCSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-(1-nitrosopyrrolidin-2-yl)pyridine |
| InChIKey | XKABJYQDMJTNGQ-DNZPNURCSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C2CCCN2N=O)[2H] |
Computed by PubChem (NCBI)