CAS 2726380-44-3 appears in our catalog under these names: (R,S)-N'-Nitrosonornicotine-13C6, (R,S)-N’-Nitrosonornicotine-13C6. Offered by: TRC. Available pack sizes: 0,5mg, 10mg, 1mg.
3-(1-nitroso(213C)azolidin-2-yl)(2,3,4,5,6-13C5)pyridine (CAS 2726380-44-3) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 183.16 g/mol. IUPAC name: 3-(1-nitroso(213C)azolidin-2-yl)(2,3,4,5,6-13C5)pyridine. InChIKey: XKABJYQDMJTNGQ-QKTVPOICSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 3-(1-nitroso(213C)azolidin-2-yl)(2,3,4,5,6-13C5)pyridine |
| InChIKey | XKABJYQDMJTNGQ-QKTVPOICSA-N |
| SMILES | C1C[13CH](N(C1)N=O)[13C]2=[13CH]N=[13CH][13CH]=[13CH]2 |
Computed by PubChem (NCBI)