CAS 1426246-59-4 appears in our catalog under these names: 3–Chloro–4–morpholinophenylboronic Acid, 3-Chloro-4-morpholinophenylboronic acid, 96%, 3-Chloro-4-morpholinophenylboronic Acid 98%, 3-CHLORO-4-MORPHOLINOPHENYLBORONIC ACID, 98%, 3-Chloro-4-morpholinophenylboronic Acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3-chloro-4-morpholin-4-ylphenyl)boronic acid (CAS 1426246-59-4) is a chemical compound with the molecular formula C10H13BClNO3 and a molecular weight of 241.48 g/mol. IUPAC name: (3-chloro-4-morpholin-4-ylphenyl)boronic acid. InChIKey: MLYNSBCEZWQQEF-UHFFFAOYSA-N.
| Molecular formula | C10H13BClNO3 |
|---|---|
| Molecular weight | 241.48 g/mol |
| IUPAC name | (3-chloro-4-morpholin-4-ylphenyl)boronic acid |
| InChIKey | MLYNSBCEZWQQEF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2CCOCC2)Cl)(O)O |
Computed by PubChem (NCBI)