CAS 2225181-64-4 appears in our catalog under these names: 2–Chloro–4–(morpholino)phenylboronic acid, 2-Chloro-4-(morpholino)phenylboronic acid, 96%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 10mg, 25mg, 5g, 10g, 25g, 1g, 250mg.
(2-chloro-4-morpholin-4-ylphenyl)boronic acid (CAS 2225181-64-4) is a chemical compound with the molecular formula C10H13BClNO3 and a molecular weight of 241.48 g/mol. IUPAC name: (2-chloro-4-morpholin-4-ylphenyl)boronic acid. InChIKey: NZHYQLUYOAZSAH-UHFFFAOYSA-N.
| Molecular formula | C10H13BClNO3 |
|---|---|
| Molecular weight | 241.48 g/mol |
| IUPAC name | (2-chloro-4-morpholin-4-ylphenyl)boronic acid |
| InChIKey | NZHYQLUYOAZSAH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCOCC2)Cl)(O)O |
Computed by PubChem (NCBI)