Products 874288-10-5
CAS 874288-10-5 appears in our catalog under these names: N-(3-Chloropropyl) 3-boronobenzamide, 98%, N-(3-Chloropropyl) 3-boronobenzamide, 98%, 98%, (3-((3-Chloropropyl)carbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg, 25g.
[3-(3-chloropropylcarbamoyl)phenyl]boronic acid (CAS 874288-10-5) is a chemical compound with the molecular formula C10H13BClNO3 and a molecular weight of 241.48 g/mol. IUPAC name: [3-(3-chloropropylcarbamoyl)phenyl]boronic acid. InChIKey: VTJIILRCPRVUHJ-UHFFFAOYSA-N.
| Molecular formula | C10H13BClNO3 |
|---|---|
| Molecular weight | 241.48 g/mol |
| IUPAC name | [3-(3-chloropropylcarbamoyl)phenyl]boronic acid |
| InChIKey | VTJIILRCPRVUHJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NCCCCl)(O)O |
Computed by PubChem (NCBI)