Products 871332-93-3
CAS 871332-93-3 appears in our catalog under these names: 4-Chloro-3-(n-propylaminocarbonyl)phenylboronic acid, 98%, (4-Chloro-3-(propylcarbamoyl)phenyl)boronic acid, 95%, (4-Chloro-3-(propylcarbamoyl)phenyl)boronic acid, 98%, (4-Chloro-3-(propylcarbamoyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 250mg.
[4-chloro-3-(propylcarbamoyl)phenyl]boronic acid (CAS 871332-93-3) is a chemical compound with the molecular formula C10H13BClNO3 and a molecular weight of 241.48 g/mol. IUPAC name: [4-chloro-3-(propylcarbamoyl)phenyl]boronic acid. InChIKey: XLTPPRMTVOUDFG-UHFFFAOYSA-N.
| Molecular formula | C10H13BClNO3 |
|---|---|
| Molecular weight | 241.48 g/mol |
| IUPAC name | [4-chloro-3-(propylcarbamoyl)phenyl]boronic acid |
| InChIKey | XLTPPRMTVOUDFG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)NCCC)(O)O |
Computed by PubChem (NCBI)