CAS 1426293-61-9 is the registry number for PAM-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(furan-2-yl)-N-(4-methylphenyl)prop-2-enamide (CAS 1426293-61-9) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: (E)-3-(furan-2-yl)-N-(4-methylphenyl)prop-2-enamide. InChIKey: DJMZLFDVBHWQTH-CMDGGOBGSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (E)-3-(furan-2-yl)-N-(4-methylphenyl)prop-2-enamide |
| InChIKey | DJMZLFDVBHWQTH-CMDGGOBGSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)/C=C/C2=CC=CO2 |
Computed by PubChem (NCBI)