Products 1426937-93-0
CAS 1426937-93-0 is the registry number for p53 Activator 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3S)-7-(hydroxymethyl)-5-methyl-3-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-6-yl]methanol (CAS 1426937-93-0) is a chemical compound with the molecular formula C15H17NO2S and a molecular weight of 275.4 g/mol. IUPAC name: [(3S)-7-(hydroxymethyl)-5-methyl-3-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-6-yl]methanol. InChIKey: YZIMIQPVZGYIAY-HNNXBMFYSA-N.
| Molecular formula | C15H17NO2S |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | [(3S)-7-(hydroxymethyl)-5-methyl-3-phenyl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-6-yl]methanol |
| InChIKey | YZIMIQPVZGYIAY-HNNXBMFYSA-N |
| SMILES | CC1=C(C(=C2N1[C@@H](SC2)C3=CC=CC=C3)CO)CO |
Computed by PubChem (NCBI)
Synonyms:
p53 Activator 8, orb2565592