CAS 1427053-53-9 is the registry number for 1-Benzo(b)thien-4-yl-piperazine, d8. Offered by: TRC. Available pack sizes: 100mg.
1-(1-benzothiophen-4-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazine (CAS 1427053-53-9) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 226.37 g/mol. IUPAC name: 1-(1-benzothiophen-4-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazine. InChIKey: VMIRJNDPLCQEHB-YEBVBAJPSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 226.37 g/mol |
| IUPAC name | 1-(1-benzothiophen-4-yl)-2,2,3,3,5,5,6,6-octadeuteriopiperazine |
| InChIKey | VMIRJNDPLCQEHB-YEBVBAJPSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=C3C=CSC3=CC=C2)([2H])[2H])[2H] |
Computed by PubChem (NCBI)