CAS 1427083-36-0 appears in our catalog under these names: 5-Cyano-6-hydroxynicotinic Acid, ≥95%, ≥95%, 5-cyano-6-oxo-1,6-dihydropyridine-3-carboxylic acid, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-cyano-6-oxo-1H-pyridine-3-carboxylic acid (CAS 1427083-36-0) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 5-cyano-6-oxo-1H-pyridine-3-carboxylic acid. InChIKey: BNNQTMPZASYUQJ-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 5-cyano-6-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | BNNQTMPZASYUQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1C(=O)O)C#N |
Computed by PubChem (NCBI)