Products 1427083-87-1

CAS 1427083-87-1 is the registry number for 5-Iodo-3-methylpicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-iodo-3-methylpyridine-2-carboxylic acid (CAS 1427083-87-1) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 5-iodo-3-methylpyridine-2-carboxylic acid. InChIKey: BXLZCZFKKJFYLH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6INO2
Molecular weight263.03 g/mol
IUPAC name5-iodo-3-methylpyridine-2-carboxylic acid
InChIKeyBXLZCZFKKJFYLH-UHFFFAOYSA-N
SMILESCC1=CC(=CN=C1C(=O)O)I

Computed by PubChem (NCBI)