Products 142719-82-2
CAS 142719-82-2 is the registry number for 3-(3-Bromophenyl)-3-(trifluoromethyl)-3H-diazirine 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(3-bromophenyl)-3-(trifluoromethyl)diazirine (CAS 142719-82-2) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 3-(3-bromophenyl)-3-(trifluoromethyl)diazirine. InChIKey: LQIQMTGLNVXNCE-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 3-(3-bromophenyl)-3-(trifluoromethyl)diazirine |
| InChIKey | LQIQMTGLNVXNCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2(N=N2)C(F)(F)F |
Computed by PubChem (NCBI)