Products 1427367-83-6
CAS 1427367-83-6 is the registry number for 3-Bromo-6,7-dimethylpyrazolo(1,5-a)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-6,7-dimethylpyrazolo[1,5-a]pyridine (CAS 1427367-83-6) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 3-bromo-6,7-dimethylpyrazolo[1,5-a]pyridine. InChIKey: IFKGSJCSVWVLOA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 3-bromo-6,7-dimethylpyrazolo[1,5-a]pyridine |
| InChIKey | IFKGSJCSVWVLOA-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=C(C=N2)Br)C=C1)C |
Computed by PubChem (NCBI)