CAS 1427405-43-3 is the registry number for Methyl 4-Chloro-6-benzofurancarboxylate. Offered by: TRC. Available pack sizes: 250mg.
Methyl 4-chloro-1-benzofuran-6-carboxylate (CAS 1427405-43-3) is a chemical compound with the molecular formula C10H7ClO3 and a molecular weight of 210.61 g/mol. IUPAC name: methyl 4-chloro-1-benzofuran-6-carboxylate. InChIKey: UAHOSGDBIFPDCT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO3 |
|---|---|
| Molecular weight | 210.61 g/mol |
| IUPAC name | methyl 4-chloro-1-benzofuran-6-carboxylate |
| InChIKey | UAHOSGDBIFPDCT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CO2)C(=C1)Cl |
Computed by PubChem (NCBI)