Products 1427445-42-8
CAS 1427445-42-8 is the registry number for 3-BROMO-6-CHLORO-8-FLUOROIMIDAZO[1,2-A]PYRIDINE, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-6-chloro-8-fluoroimidazo[1,2-a]pyridine (CAS 1427445-42-8) is a chemical compound with the molecular formula C7H3BrClFN2 and a molecular weight of 249.47 g/mol. IUPAC name: 3-bromo-6-chloro-8-fluoroimidazo[1,2-a]pyridine. InChIKey: SZOMVMQIEMXWKK-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFN2 |
|---|---|
| Molecular weight | 249.47 g/mol |
| IUPAC name | 3-bromo-6-chloro-8-fluoroimidazo[1,2-a]pyridine |
| InChIKey | SZOMVMQIEMXWKK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=C(N2C=C1Cl)Br)F |
Computed by PubChem (NCBI)