Products 1427504-03-7
CAS 1427504-03-7 is the registry number for methyl 4-fluoro-1H-indazole-3-carboxylate. Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl 4-fluoro-1H-indazole-3-carboxylate (CAS 1427504-03-7) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 4-fluoro-1H-indazole-3-carboxylate. InChIKey: CRZHEJHYCVPWEC-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 4-fluoro-1H-indazole-3-carboxylate |
| InChIKey | CRZHEJHYCVPWEC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNC2=C1C(=CC=C2)F |
Computed by PubChem (NCBI)