CAS 142810-49-9 is the registry number for N-(4-Chlorophenyl)cyclohexanecarboxamide, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
N-(4-chlorophenyl)cyclohexanecarboxamide (CAS 142810-49-9) is a chemical compound with the molecular formula C13H16ClNO and a molecular weight of 237.72 g/mol. IUPAC name: N-(4-chlorophenyl)cyclohexanecarboxamide. InChIKey: RVJKIPFPMXENNO-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO |
|---|---|
| Molecular weight | 237.72 g/mol |
| IUPAC name | N-(4-chlorophenyl)cyclohexanecarboxamide |
| InChIKey | RVJKIPFPMXENNO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)