Products 1428139-08-5
CAS 1428139-08-5 is the registry number for Methyl 3-amino-6-(5-methyl-2-thienyl)-4-oxo-4,5,6,7-tetrahydro-1h-indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-amino-6-(5-methylthiophen-2-yl)-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate (CAS 1428139-08-5) is a chemical compound with the molecular formula C15H16N2O3S and a molecular weight of 304.4 g/mol. IUPAC name: methyl 3-amino-6-(5-methylthiophen-2-yl)-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate. InChIKey: YAFZHCFMCSPBNF-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O3S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | methyl 3-amino-6-(5-methylthiophen-2-yl)-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
| InChIKey | YAFZHCFMCSPBNF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2CC3=C(C(=O)C2)C(=C(N3)C(=O)OC)N |
Computed by PubChem (NCBI)