Products 1810761-43-3
CAS 1810761-43-3 appears in our catalog under these names: Etoricoxib Impurity 30, Etoricoxib Impurity 55, 1-(6-Methyl-3-pyridinyl)-2-(4-(methylsulfonyl)phenyl)-ethanone Oxime. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(NZ)-N-[1-(6-methyl-3-pyridinyl)-2-(4-methylsulfonylphenyl)ethylidene]hydroxylamine (CAS 1810761-43-3) is a chemical compound with the molecular formula C15H16N2O3S and a molecular weight of 304.4 g/mol. IUPAC name: (NZ)-N-[1-(6-methyl-3-pyridinyl)-2-(4-methylsulfonylphenyl)ethylidene]hydroxylamine. InChIKey: GYTLYWQDGKQKLH-ICFOKQHNSA-N.
| Molecular formula | C15H16N2O3S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (NZ)-N-[1-(6-methyl-3-pyridinyl)-2-(4-methylsulfonylphenyl)ethylidene]hydroxylamine |
| InChIKey | GYTLYWQDGKQKLH-ICFOKQHNSA-N |
| SMILES | CC1=NC=C(C=C1)/C(=N\O)/CC2=CC=C(C=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)