CAS 956568-49-3 appears in our catalog under these names: ([4-Formyl-3-methyl-1-(4-methylbenzyl)-1h-pyrazol-5-yl]thio)acetic acid, 95%, 2-({4-Formyl-3-methyl-1-((4-methylphenyl)methyl)-1H-pyrazol-5-yl}sulfanyl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-[4-formyl-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-5-yl]sulfanylacetic acid (CAS 956568-49-3) is a chemical compound with the molecular formula C15H16N2O3S and a molecular weight of 304.4 g/mol. IUPAC name: 2-[4-formyl-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-5-yl]sulfanylacetic acid. InChIKey: PAVDPRMTBAZXAG-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O3S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 2-[4-formyl-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-5-yl]sulfanylacetic acid |
| InChIKey | PAVDPRMTBAZXAG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C(=C(C(=N2)C)C=O)SCC(=O)O |
Computed by PubChem (NCBI)