CAS 1951425-05-0 is the registry number for (R)N-(1-Benzenesulfonyl-aziridin-2-yl)-o-benzyl-hydroxylamine, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(2R)-1-(benzenesulfonyl)-N-phenylmethoxyaziridin-2-amine (CAS 1951425-05-0) is a chemical compound with the molecular formula C15H16N2O3S and a molecular weight of 304.4 g/mol. IUPAC name: (2R)-1-(benzenesulfonyl)-N-phenylmethoxyaziridin-2-amine. InChIKey: WVENTICFGOVOKY-LDCVWXEPSA-N.
| Molecular formula | C15H16N2O3S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (2R)-1-(benzenesulfonyl)-N-phenylmethoxyaziridin-2-amine |
| InChIKey | WVENTICFGOVOKY-LDCVWXEPSA-N |
| SMILES | C1[C@@H](N1S(=O)(=O)C2=CC=CC=C2)NOCC3=CC=CC=C3 |
Computed by PubChem (NCBI)