Products 160351-14-4
CAS 160351-14-4 is the registry number for tert-Butyl 5-hydroxythieno[3,4-f][1,7]naphthyridine-4(5H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 5-hydroxy-5H-thieno[3,4-f][1,7]naphthyridine-4-carboxylate (CAS 160351-14-4) is a chemical compound with the molecular formula C15H16N2O3S and a molecular weight of 304.4 g/mol. IUPAC name: tert-butyl 5-hydroxy-5H-thieno[3,4-f][1,7]naphthyridine-4-carboxylate. InChIKey: JCOYKPQFGPDJPY-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O3S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | tert-butyl 5-hydroxy-5H-thieno[3,4-f][1,7]naphthyridine-4-carboxylate |
| InChIKey | JCOYKPQFGPDJPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(C2=C(C=CC=N2)C3=CSC=C31)O |
Computed by PubChem (NCBI)