Products 1428234-51-8

CAS 1428234-51-8 appears in our catalog under these names: 2,6-Difluoro-3-(methylthio)benzoic acid, 95%, 2,6-Difluoro-3-(methylthio)benzoic acid, 97%, 2,6-Difluoro-3-(methylthio)benzoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,6-difluoro-3-methylsulfanylbenzoic acid (CAS 1428234-51-8) is a chemical compound with the molecular formula C8H6F2O2S and a molecular weight of 204.20 g/mol. IUPAC name: 2,6-difluoro-3-methylsulfanylbenzoic acid. InChIKey: CYFIPPYTMKMXGP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O2S
Molecular weight204.20 g/mol
IUPAC name2,6-difluoro-3-methylsulfanylbenzoic acid
InChIKeyCYFIPPYTMKMXGP-UHFFFAOYSA-N
SMILESCSC1=C(C(=C(C=C1)F)C(=O)O)F

Computed by PubChem (NCBI)