Products 1428234-51-8
CAS 1428234-51-8 appears in our catalog under these names: 2,6-Difluoro-3-(methylthio)benzoic acid, 95%, 2,6-Difluoro-3-(methylthio)benzoic acid, 97%, 2,6-Difluoro-3-(methylthio)benzoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,6-difluoro-3-methylsulfanylbenzoic acid (CAS 1428234-51-8) is a chemical compound with the molecular formula C8H6F2O2S and a molecular weight of 204.20 g/mol. IUPAC name: 2,6-difluoro-3-methylsulfanylbenzoic acid. InChIKey: CYFIPPYTMKMXGP-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2S |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 2,6-difluoro-3-methylsulfanylbenzoic acid |
| InChIKey | CYFIPPYTMKMXGP-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)