Products 867311-53-3
CAS 867311-53-3 is the registry number for [(3,4-Difluorophenyl)thio]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-(3,4-difluorophenyl)sulfanylacetic acid (CAS 867311-53-3) is a chemical compound with the molecular formula C8H6F2O2S and a molecular weight of 204.20 g/mol. IUPAC name: 2-(3,4-difluorophenyl)sulfanylacetic acid. InChIKey: CCXYYCKQHVEJES-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2S |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)sulfanylacetic acid |
| InChIKey | CCXYYCKQHVEJES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SCC(=O)O)F)F |
Computed by PubChem (NCBI)