CAS 4837-26-7 appears in our catalog under these names: 4-[(Difluoromethyl)thio]benzoic acid, 95%, 4-((Difluoromethyl)thio)benzoic acid, 97%, 4-[(Difluoromethyl)thio]benzoic acid, 98%, 98%, 4-[(difluoromethyl)sulfanyl]benzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 50mg, 500mg, 2.5g.
4-(difluoromethylsulfanyl)benzoic acid (CAS 4837-26-7) is a chemical compound with the molecular formula C8H6F2O2S and a molecular weight of 204.20 g/mol. IUPAC name: 4-(difluoromethylsulfanyl)benzoic acid. InChIKey: ZZJSQHYCIPFNKN-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2S |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 4-(difluoromethylsulfanyl)benzoic acid |
| InChIKey | ZZJSQHYCIPFNKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)SC(F)F |
Computed by PubChem (NCBI)