Products 773108-57-9
CAS 773108-57-9 appears in our catalog under these names: 2,4-Difluoro-phenylthioacetic acid, 95%, 2,4-Difluoro-phenylthioacetic acid, 95+%, 2-((2,4-difluorophenyl)sulfanyl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 5g, 1g, 2,5g.
2-(2,4-difluorophenyl)sulfanylacetic acid (CAS 773108-57-9) is a chemical compound with the molecular formula C8H6F2O2S and a molecular weight of 204.20 g/mol. IUPAC name: 2-(2,4-difluorophenyl)sulfanylacetic acid. InChIKey: DGMMJRBTUKGZRY-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2S |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)sulfanylacetic acid |
| InChIKey | DGMMJRBTUKGZRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)SCC(=O)O |
Computed by PubChem (NCBI)