Products 142854-48-6

CAS 142854-48-6 is the registry number for 3-Boc-amino-4-phenylbutyric acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate (CAS 142854-48-6) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate. InChIKey: QNLBBFLTUQDDIB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23NO4
Molecular weight293.36 g/mol
IUPAC namemethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoate
InChIKeyQNLBBFLTUQDDIB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC1=CC=CC=C1)CC(=O)OC

Computed by PubChem (NCBI)