Products 1428772-57-9
CAS 1428772-57-9 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carbaldehyde, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carbaldehyde (CAS 1428772-57-9) is a chemical compound with the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carbaldehyde. InChIKey: JUNDFUDUKHGXPE-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO3 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carbaldehyde |
| InChIKey | JUNDFUDUKHGXPE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)NC=C3C=O |
Computed by PubChem (NCBI)