CAS 142885-95-8 appears in our catalog under these names: (3,5-Dimethyl-4-nitropyridin-2-yl)methyl acetate, 97%, Esomeprazole Impurity 31, Esomeprazole Impurity 62. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3,5-dimethyl-4-nitro-2-pyridinyl)methyl acetate (CAS 142885-95-8) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: (3,5-dimethyl-4-nitro-2-pyridinyl)methyl acetate. InChIKey: NQXDXTJWDZWWAX-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | (3,5-dimethyl-4-nitro-2-pyridinyl)methyl acetate |
| InChIKey | NQXDXTJWDZWWAX-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1[N+](=O)[O-])C)COC(=O)C |
Computed by PubChem (NCBI)