CAS 1428866-21-0 is the registry number for 5,8–Dibromo–3–fluoroquinoline. Offered by: GLPBio. Available pack sizes: 1g, 5g.
5,8-dibromo-3-fluoroquinoline (CAS 1428866-21-0) is a chemical compound with the molecular formula C9H4Br2FN and a molecular weight of 304.94 g/mol. IUPAC name: 5,8-dibromo-3-fluoroquinoline. InChIKey: BZESNPMENZCZFM-UHFFFAOYSA-N.
| Molecular formula | C9H4Br2FN |
|---|---|
| Molecular weight | 304.94 g/mol |
| IUPAC name | 5,8-dibromo-3-fluoroquinoline |
| InChIKey | BZESNPMENZCZFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)C=C(C=N2)F)Br |
Computed by PubChem (NCBI)