Products 1428940-36-6
CAS 1428940-36-6 appears in our catalog under these names: 4-(Chloromethyl)-3-(trifluoromethyl)pyridine hydrochloride, 95%, 95%, 4-(Chloromethyl)-3-(trifluoromethyl)pyridine hydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(chloromethyl)-3-(trifluoromethyl)pyridine;hydrochloride (CAS 1428940-36-6) is a chemical compound with the molecular formula C7H6Cl2F3N and a molecular weight of 232.03 g/mol. IUPAC name: 4-(chloromethyl)-3-(trifluoromethyl)pyridine;hydrochloride. InChIKey: PWVGLBKTBVXFPL-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2F3N |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 4-(chloromethyl)-3-(trifluoromethyl)pyridine;hydrochloride |
| InChIKey | PWVGLBKTBVXFPL-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1CCl)C(F)(F)F.Cl |
Computed by PubChem (NCBI)