CAS 1803590-66-0 is the registry number for 3-(Chloromethyl)-5-(trifluoromethyl)pyridine hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3-(chloromethyl)-5-(trifluoromethyl)pyridine;hydrochloride (CAS 1803590-66-0) is a chemical compound with the molecular formula C7H6Cl2F3N and a molecular weight of 232.03 g/mol. IUPAC name: 3-(chloromethyl)-5-(trifluoromethyl)pyridine;hydrochloride. InChIKey: JQDSZQDCXIUSBD-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2F3N |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 3-(chloromethyl)-5-(trifluoromethyl)pyridine;hydrochloride |
| InChIKey | JQDSZQDCXIUSBD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1C(F)(F)F)CCl.Cl |
Computed by PubChem (NCBI)