CAS 856250-59-4 appears in our catalog under these names: 2-(Chloromethyl)-5-(trifluoromethyl)pyridine hydrochloride, 95%, 2-(Chloromethyl)-5-(trifluoromethyl)pyridine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 100mg, 5g, 25g.
2-(chloromethyl)-5-(trifluoromethyl)pyridine;hydrochloride (CAS 856250-59-4) is a chemical compound with the molecular formula C7H6Cl2F3N and a molecular weight of 232.03 g/mol. IUPAC name: 2-(chloromethyl)-5-(trifluoromethyl)pyridine;hydrochloride. InChIKey: LCLXKLCMJTUIRQ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2F3N |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(trifluoromethyl)pyridine;hydrochloride |
| InChIKey | LCLXKLCMJTUIRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)CCl.Cl |
Computed by PubChem (NCBI)