CAS 648415-76-3 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)aniline hydrochloride, 97%, 97%, 4-Chloro-2-(trifluoromethyl)aniline hydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
4-chloro-2-(trifluoromethyl)aniline;hydrochloride (CAS 648415-76-3) is a chemical compound with the molecular formula C7H6Cl2F3N and a molecular weight of 232.03 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)aniline;hydrochloride. InChIKey: DVGCDMNTSJRNQV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2F3N |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | DVGCDMNTSJRNQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)