CAS 1428972-97-7 is the registry number for tert-Butyl 3-formyl-1H-pyrrolo[3,2-b]pyridine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-formylpyrrolo[3,2-b]pyridine-1-carboxylate (CAS 1428972-97-7) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: tert-butyl 3-formylpyrrolo[3,2-b]pyridine-1-carboxylate. InChIKey: MKBXOJUMDBDIIF-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | tert-butyl 3-formylpyrrolo[3,2-b]pyridine-1-carboxylate |
| InChIKey | MKBXOJUMDBDIIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC=N2)C=O |
Computed by PubChem (NCBI)