Products 1429220-15-4
CAS 1429220-15-4 is the registry number for rac-cis-1-Deshydroxy Rasagiline. Offered by: TRC. Available pack sizes: 100mg.
(1S,3R)-3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-1-ol (CAS 1429220-15-4) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: (1S,3R)-3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-1-ol. InChIKey: NMAOXAKDLRBCFC-NEPJUHHUSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (1S,3R)-3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-1-ol |
| InChIKey | NMAOXAKDLRBCFC-NEPJUHHUSA-N |
| SMILES | C#CCN[C@@H]1C[C@@H](C2=CC=CC=C12)O |
Computed by PubChem (NCBI)