Products 1429420-03-0

CAS 1429420-03-0 is the registry number for Olmesartan Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(4-phenylphenyl)methyl]imidazole-4-carboxylic acid (CAS 1429420-03-0) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 3-[(4-phenylphenyl)methyl]imidazole-4-carboxylic acid. InChIKey: OXRMQBIEGBLFPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O2
Molecular weight278.30 g/mol
IUPAC name3-[(4-phenylphenyl)methyl]imidazole-4-carboxylic acid
InChIKeyOXRMQBIEGBLFPJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(C=C2)CN3C=NC=C3C(=O)O

Computed by PubChem (NCBI)