CAS 1429436-06-5 appears in our catalog under these names: 3,3'–(Pyridine–3,5–diyl)dibenzoic acid, 3,3'-(Pyridine-3,5-diyl)dibenzoic acid 97%, 3,3'-(Pyridine-3,5-diyl)dibenzoic acid, 97%, 97%, 3,3'-(Pyridine-3,5-diyl)dibenzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 25g.
3-[5-(3-carboxyphenyl)-3-pyridinyl]benzoic acid (CAS 1429436-06-5) is a chemical compound with the molecular formula C19H13NO4 and a molecular weight of 319.3 g/mol. IUPAC name: 3-[5-(3-carboxyphenyl)-3-pyridinyl]benzoic acid. InChIKey: DMZIXVHACOAZQC-UHFFFAOYSA-N.
| Molecular formula | C19H13NO4 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 3-[5-(3-carboxyphenyl)-3-pyridinyl]benzoic acid |
| InChIKey | DMZIXVHACOAZQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CN=C2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)