Products 2022152-71-0
CAS 2022152-71-0 appears in our catalog under these names: 4'–(Pyridin–4–yl)–(1,1'–biphenyl)–3,5–dicarboxylic acid, 4'-(Pyridin-4-yl)-[1,1'-biphenyl]-3,5-dicarboxylic acid 98%, 4'-(Pyridin-4-yl)-[1,1'-biphenyl]-3,5-dicarboxylic acid, 98%, 98%, 4'-(Pyridin-4-yl)-[1,1'-biphenyl]-3,5-dicarboxylic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
5-(4-pyridin-4-ylphenyl)benzene-1,3-dicarboxylic acid (CAS 2022152-71-0) is a chemical compound with the molecular formula C19H13NO4 and a molecular weight of 319.3 g/mol. IUPAC name: 5-(4-pyridin-4-ylphenyl)benzene-1,3-dicarboxylic acid. InChIKey: ZCPSJVXVYUXFHI-UHFFFAOYSA-N.
| Molecular formula | C19H13NO4 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 5-(4-pyridin-4-ylphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | ZCPSJVXVYUXFHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)