Products 1429636-73-6
CAS 1429636-73-6 appears in our catalog under these names: 7-(2,2-Dihydroxyethyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, 95%, 95%, Doxofylline Impurity 9. Offered by: Chemat, Chemat Brand. Available pack sizes: 100mg, on request.
7-(2,2-dihydroxyethyl)-1,3-dimethylpurine-2,6-dione (CAS 1429636-73-6) is a chemical compound with the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. IUPAC name: 7-(2,2-dihydroxyethyl)-1,3-dimethylpurine-2,6-dione. InChIKey: GKECLIBGXKGDAD-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O4 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | 7-(2,2-dihydroxyethyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | GKECLIBGXKGDAD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(O)O |
Computed by PubChem (NCBI)