CAS 62637-09-6 is the registry number for Doxofylline Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.
7-(2,3-dihydroxypropyl)-3-methylpurine-2,6-dione (CAS 62637-09-6) is a chemical compound with the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. IUPAC name: 7-(2,3-dihydroxypropyl)-3-methylpurine-2,6-dione. InChIKey: CEQTZOYQHCHZTF-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O4 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | 7-(2,3-dihydroxypropyl)-3-methylpurine-2,6-dione |
| InChIKey | CEQTZOYQHCHZTF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC1=O)N(C=N2)CC(CO)O |
Computed by PubChem (NCBI)