CAS 1864760-35-9 is the registry number for Methyl 3-(dimethylamino)-2-(4-nitropyrazol-1-yl)prop-2-enoate, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl (Z)-3-(dimethylamino)-2-(4-nitropyrazol-1-yl)prop-2-enoate (CAS 1864760-35-9) is a chemical compound with the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. IUPAC name: methyl (Z)-3-(dimethylamino)-2-(4-nitropyrazol-1-yl)prop-2-enoate. InChIKey: HKSDGOQJZLUDAM-VURMDHGXSA-N.
| Molecular formula | C9H12N4O4 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | methyl (Z)-3-(dimethylamino)-2-(4-nitropyrazol-1-yl)prop-2-enoate |
| InChIKey | HKSDGOQJZLUDAM-VURMDHGXSA-N |
| SMILES | CN(C)/C=C(/C(=O)OC)\N1C=C(C=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)