Products 478801-48-8
CAS 478801-48-8 appears in our catalog under these names: 5-Azidopentanoic acid n-hydroxysuccinimide ester, 95%, N3-C4-NHS ester, N3–C4–NHS ester, N3-C4-NHS ester 95%, 5-Azidopentanoic acid N-hydroxysuccinimide ester, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2,5-dioxopyrrolidin-1-yl) 5-azidopentanoate (CAS 478801-48-8) is a chemical compound with the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-azidopentanoate. InChIKey: PJHPYOOVTLZAOG-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O4 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-azidopentanoate |
| InChIKey | PJHPYOOVTLZAOG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)