Products 944779-25-3

CAS 944779-25-3 is the registry number for 4-(2-(3-Methyl-1H-pyrazole-5-carbonyl)hydrazinyl)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2-(5-methyl-1H-pyrazole-3-carbonyl)hydrazinyl]-4-oxobutanoic acid (CAS 944779-25-3) is a chemical compound with the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. IUPAC name: 4-[2-(5-methyl-1H-pyrazole-3-carbonyl)hydrazinyl]-4-oxobutanoic acid. InChIKey: RFOAGWNGDOSWSI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N4O4
Molecular weight240.22 g/mol
IUPAC name4-[2-(5-methyl-1H-pyrazole-3-carbonyl)hydrazinyl]-4-oxobutanoic acid
InChIKeyRFOAGWNGDOSWSI-UHFFFAOYSA-N
SMILESCC1=CC(=NN1)C(=O)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)