CAS 1429639-85-9 appears in our catalog under these names: 7,7-Dimethyl-5,7-dihydrothieno(3,4-d)pyrimidine-2,4(1H,3H)-dione, 95%, 7,7-DIMETHYL-5,7-DIHYDROTHIENO[3,4-D]PYRIMIDINE-2,4(1H,3H)-DIONE, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
7,7-dimethyl-1,5-dihydrothieno[3,4-d]pyrimidine-2,4-dione (CAS 1429639-85-9) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 7,7-dimethyl-1,5-dihydrothieno[3,4-d]pyrimidine-2,4-dione. InChIKey: DSKXWEAQAVCVMY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 7,7-dimethyl-1,5-dihydrothieno[3,4-d]pyrimidine-2,4-dione |
| InChIKey | DSKXWEAQAVCVMY-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CS1)C(=O)NC(=O)N2)C |
Computed by PubChem (NCBI)